For research use only. Not for therapeutic Use.
Cinanserin（Cat No.:M048022） is a synthetic compound. It belongs to the class of drugs known as serotonin antagonists, specifically targeting the serotonin 2A (5-HT₂A) receptors. Initially researched as a potential antidepressant and antihypertensive agent, cinanserin has been studied for its pharmacological effects on serotonin-mediated processes. While it is not widely used clinically today, its ability to block serotonin receptors has made it a useful tool in scientific research to explore the role of serotonin in various physiological and pathological processes, including mood regulation and cardiovascular function.
| Catalog Number | M048022 |
| CAS Number | 1166-34-3 |
| Molecular Formula | C20H25ClN2OS |
| Purity | ≥95% |
| Storage | Desiccate at +4C |
| IUPAC Name | (E)-N-[2-[3-(dimethylamino)propylsulfanyl]phenyl]-3-phenylprop-2-enamide |
| InChI | InChI=1S/C20H24N2OS/c1-22(2)15-8-16-24-19-12-7-6-11-18(19)21-20(23)14-13-17-9-4-3-5-10-17/h3-7,9-14H,8,15-16H2,1-2H3,(H,21,23)/b14-13+ |
| InChIKey | RSUVYMGADVXGOU-BUHFOSPRSA-N |
| SMILES | CN(C)CCCSC1=CC=CC=C1NC(=O)C=CC2=CC=CC=C2 |
