Cinnamic acid-13C3（Cat No.:R033672） is a labeled form of cinnamic acid where three carbon atoms are enriched with carbon-13 (13C). This isotopic labeling significantly enhances the molecule’s traceability and stability in analytical studies, especially useful in nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry. Cinnamic acid is a key intermediate in the biosynthesis of flavonoids and is also widely used in the fragrance industry and as a precursor for synthesizing various pharmaceuticals. The 13C-labeled version allows researchers to track and study the incorporation and metabolism of cinnamic acid in biological and environmental systems more precisely.
| Catalog Number | R033672 |
| CAS Number | NA |
| Synonyms | 3-Phenyl-2-propenoic Acid-1,2,3-13C3; 3-Phenylacrylic Acid-1,2,3-13C3; NSC 623441-1,2,3-13C3; NSC 9189-1,2,3-13C3; Phenylacrylic Acid-1,2,3-13C3; β-Phenylacrylic Acid-1,2,3-13C3; |
| Molecular Formula | C₆¹³C₃H₆O₂ |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | (E)-3-phenyl(1,2,3-13C3)prop-2-enoic acid |
| InChI | InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+/i6+1,7+1,9+1 |
| InChIKey | WBYWAXJHAXSJNI-JOCCQEFWSA-N |
| SMILES | C1=CC=C(C=C1)C=CC(=O)O |
