For research use only. Not for therapeutic Use.
Cinnamyltriphenylphosphonium bromide(Cat No.:L006843), is an organic compound used in organic synthesis and catalysis. Its molecular structure contains a cinnamyl group attached to a triphenylphosphonium moiety, with a bromine atom as the counterion. This compound is employed as a phase transfer catalyst and as a reagent in various chemical transformations. It facilitates reactions that occur between reactants present in different phases, enhancing the efficiency of the synthesis process.
CAS Number | 7310-74-9 |
Molecular Formula | C27H24BrP |
Purity | ≥95% |
IUPAC Name | triphenyl-[(E)-3-phenylprop-2-enyl]phosphanium;bromide |
InChI | InChI=1S/C27H24P.BrH/c1-5-14-24(15-6-1)16-13-23-28(25-17-7-2-8-18-25,26-19-9-3-10-20-26)27-21-11-4-12-22-27;/h1-22H,23H2;1H/q+1;/p-1/b16-13+; |
InChIKey | APIBROGXENTUGB-ZUQRMPMESA-M |
SMILES | C1=CC=C(C=C1)C=CC[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |