For research use only. Not for therapeutic Use.
Cintriamide is an antipsychotic
| Catalog Number | I024779 |
| CAS Number | 5588-21-6 |
| Synonyms | Cintriamide; CL36746; CL-36746; CL 36746 |
| Molecular Formula | C12H15NO4 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 2-Propenamide, 3-(3,4,5-trimethoxyphenyl)- |
| InChI | InChI=1S/C12H15NO4/c1-15-9-6-8(4-5-11(13)14)7-10(16-2)12(9)17-3/h4-7H,1-3H3,(H2,13,14)/b5-4+ |
| InChIKey | LRLKZVMLJBNNPE-SNAWJCMRSA-N |
| SMILES | O=C(N)/C=C/C1=CC(OC)=C(OC)C(OC)=C1 |
