For research use only. Not for therapeutic Use.
Ciproxifan hydrochloride（Cat No.:I012717）is a chemical compound that acts as an antagonist at the histamine H3 receptor. It is primarily researched for its potential effects on the central nervous system, particularly for enhancing wakefulness and improving cognitive function. By blocking the H3 receptor, Ciproxifan may increase the release of neurotransmitters like acetylcholine, dopamine, and norepinephrine, which are involved in alertness and memory. It has been investigated for potential therapeutic applications in treating conditions such as narcolepsy, cognitive disorders, and other neurological conditions. However, its clinical use remains limited.
| Catalog Number | I012717 |
| CAS Number | 1049741-81-2 |
| Synonyms | Cyclopropyl[4-[3-(1H-imidazol-4-yl)propoxyl]phenyl]-methanone hydrochloride |
| Molecular Formula | C16H19ClN2O2 |
| Purity | ≥95% |
| IUPAC Name | cyclopropyl-[4-[3-(1H-imidazol-5-yl)propoxy]phenyl]methanone;hydrochloride |
| InChI | InChI=1S/C16H18N2O2.ClH/c19-16(12-3-4-12)13-5-7-15(8-6-13)20-9-1-2-14-10-17-11-18-14;/h5-8,10-12H,1-4,9H2,(H,17,18);1H |
| InChIKey | PWAPSKMHZQQTRJ-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=CC=C(C=C2)OCCCC3=CN=CN3.Cl |
