For research use only. Not for therapeutic Use.
Ciproxifan maleate(CAT: I002383) is a potent and selective histamine H3 receptor antagonist/inverse agonist. By blocking H3 autoreceptors, it enhances the release of histamine and other neurotransmitters such as acetylcholine, dopamine, and norepinephrine in the brain. This mechanism makes it a valuable tool in neuropharmacology research, particularly for studying cognitive function, arousal, and neurodegenerative diseases like Alzheimer’s and Parkinson’s. Ciproxifan maleate has shown potential in improving wakefulness and memory, supporting its use in exploring therapeutic strategies for conditions involving impaired histaminergic neurotransmission and central nervous system disorders.
| Catalog Number | I002383 |
| CAS Number | 184025-19-2 |
| Synonyms | (Z)-but-2-enedioic acid;cyclopropyl-[4-[3-(1H-imidazol-5-yl)propoxy]phenyl]methanone |
| Molecular Formula | C20H22N2O6 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | 10 mM in DMSO |
| Storage | 3 years -20C powder |
| IUPAC Name | (Z)-but-2-enedioic acid;cyclopropyl-[4-[3-(1H-imidazol-5-yl)propoxy]phenyl]methanone |
| InChI | InChI=1S/C16H18N2O2.C4H4O4/c19-16(12-3-4-12)13-5-7-15(8-6-13)20-9-1-2-14-10-17-11-18-14;5-3(6)1-2-4(7)8/h5-8,10-12H,1-4,9H2,(H,17,18);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | RLQFKEYRALXXEJ-BTJKTKAUSA-N |
| SMILES | C1CC1C(=O)C2=CC=C(C=C2)OCCCC3=CN=CN3.C(=C\C(=O)O)\C(=O)O |
