For research use only. Not for therapeutic Use.
Cirtuvivint（Cat No.:I024801）is a potent and selective inhibitor of the CDC-like kinase (CLK) and dual-specificity tyrosine phosphorylation-regulated kinase (DYRK) family. It plays a crucial role in regulating RNA splicing by modulating splicing factors, making it a promising candidate in cancer therapy. Cirtuvivint disrupts the proliferation of tumor cells by inhibiting the dysregulation of RNA splicing mechanisms common in various cancers. This selective inhibition may enhance its effectiveness while minimizing off-target effects, making Cirtuvivint a valuable tool for further research in oncology and therapeutic development targeting RNA splicing dysregulation.
| Catalog Number | I024801 |
| CAS Number | 2143917-62-6 |
| Synonyms | Cirtuvivint |
| Molecular Formula | C24H25N7O |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4℃ for short term (days to weeks) or -20℃ for long term (months to years). |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-N-[6-(1-methyl-1H-pyrazol-4-yl)isoquinolin-3-yl]pyridine-4-carboxamide |
| InChI | InChI=1S/C24H25N7O/c1-29-7-9-31(10-8-29)23-13-18(5-6-25-23)24(32)28-22-12-20-11-17(3-4-19(20)14-26-22)21-15-27-30(2)16-21/h3-6,11-16H,7-10H2,1-2H3,(H,26,28,32) |
| InChIKey | BQWWOBKMDWACGC-UHFFFAOYSA-N |
| SMILES | O=C(C1=CC(N2CCN(C)CC2)=NC=C1)NC3=CC4=C(C=N3)C=CC(C5=CN(C)N=C5)=C4 |
