For research use only. Not for therapeutic Use.
Eicosatrienoic Acid (20:3ω-<wbr></wbr>3) is a rare polyunsaturated fatty acid of the ω-<wbr></wbr>3 series. In normal humans, it represents less than 0.25% of serum phospholipid fatty acids. However, it is one of the most active essential fatty acids when assayed for the inhibition of fatty acid elongation/desaturation reactions which convert dietary C-<wbr></wbr>18 fatty acids to C-<wbr></wbr>20 eicosanoid precursors.
| Catalog Number | M088001 |
| CAS Number | 17046-59-2 |
| Synonyms | 11Z,14Z,17Z-eicosatrienoic acid |
| Molecular Formula | C20H34O2 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | -20°C |
| IUPAC Name | (11Z,14Z,17Z)-icosa-11,14,17-trienoic acid |
| InChI | InChI=1S/C20H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10H,2,5,8,11-19H2,1H3,(H,21,22)/b4-3-,7-6-,10-9- |
| InChIKey | AHANXAKGNAKFSK-PDBXOOCHSA-N |
| SMILES | CCC=CCC=CCC=CCCCCCCCCCC(=O)O |
