For research use only. Not for therapeutic Use.
cis-1,3-Cyclopentanedicarboxylic acid is a cyclic dicarboxylic acid featuring two carboxyl groups at the 1 and 3 positions of a cyclopentane ring. This compound is significant in organic synthesis and materials science, serving as a building block for various chemical reactions and applications. Its unique cis configuration influences its reactivity and properties, making it useful in the development of biodegradable polymers and other materials. Additionally, its structure allows for further modifications, enhancing its potential in pharmaceuticals and agrochemicals.
CAS Number | 876-05-1 |
Molecular Formula | C7H10O4 |
Purity | ≥95% |
IUPAC Name | (1S,3R)-cyclopentane-1,3-dicarboxylic acid |
InChI | InChI=1S/C7H10O4/c8-6(9)4-1-2-5(3-4)7(10)11/h4-5H,1-3H2,(H,8,9)(H,10,11)/t4-,5+ |
InChIKey | LNGJOYPCXLOTKL-SYDPRGILSA-N |
SMILES | C1C[C@@H](C[C@@H]1C(=O)O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |