For research use only. Not for therapeutic Use.
Cis-13-octadecenoic acid (Cat No.:M053374), commonly referred to as cis-vaccenic acid, is a monounsaturated omega-7 fatty acid. It’s naturally found in various plant and animal sources, including certain vegetable oils and dairy products. This acid plays a role in lipid metabolism and is considered beneficial for health due to its potential to positively influence lipid profiles and cardiovascular health. It can be metabolically converted into other fatty acids with potential anti-inflammatory properties. While research on its effects is ongoing, cis-13-octadecenoic acid’s presence in dietary sources highlights its importance in maintaining a balanced and healthful diet.
CAS Number | 13126-39-1 |
Molecular Formula | C18H34O2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (Z)-octadec-13-enoic acid |
InChI | InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h5-6H,2-4,7-17H2,1H3,(H,19,20)/b6-5- |
InChIKey | BDLLSHRIFPDGQB-WAYWQWQTSA-N |
SMILES | CCCCC=CCCCCCCCCCCCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |