For research use only. Not for therapeutic Use.
Cis-1,4-cyclohexane diamine(Cat No.:M080677) is an organic compound characterized by its cyclohexane ring with two amine groups attached at the 1st and 4th positions in a cis configuration. This spatial arrangement refers to the amine groups being on the same side of the cyclohexane ring, which is crucial for its chemical properties and reactivity. It has the molecular formula C6H14N2. This compound is commonly used in the synthesis of polymers, such as nylon and other polyamides, due to its ability to form strong and durable linkages. It also finds applications in the production of coatings, adhesives, and elastomers.
CAS Number | 15827-56-2 |
Molecular Formula | C6H14N2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | cyclohexane-1,4-diamine |
InChI | InChI=1S/C6H14N2/c7-5-1-2-6(8)4-3-5/h5-6H,1-4,7-8H2 |
InChIKey | VKIRRGRTJUUZHS-UHFFFAOYSA-N |
SMILES | C1CC(CCC1N)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |