For research use only. Not for therapeutic Use.
Cis-4-Cyclohexene-1,2-dicarboxylic acid is a cyclic dicarboxylic acid featuring a cyclohexene ring with carboxylic acid groups at the 1 and 2 positions. The cis configuration contributes to its unique chemical and physical properties, enhancing its reactivity in organic synthesis. This compound can undergo various transformations, including esterification and amidation, making it useful for developing pharmaceuticals and polymeric materials. Its dicarboxylic acid functionality allows for further derivatization, facilitating exploration in materials science and medicinal chemistry applications.
CAS Number | 2305-26-2 |
Synonyms | cis-1.2.3.6-Tetrahydrophthalic acid |
Molecular Formula | C8H10O4 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | (1S,2R)-cyclohex-4-ene-1,2-dicarboxylic acid |
InChI | InChI=1S/C8H10O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-2,5-6H,3-4H2,(H,9,10)(H,11,12)/t5-,6+ |
InChIKey | ILUAAIDVFMVTAU-OLQVQODUSA-N |
SMILES | C1C=CCC(C1C(=O)O)C(=O)O |