For research use only. Not for therapeutic Use.
cis-4-Hydroxy-L-Proline Hydrochloride (Cat.No:R073099) is a derivative of the amino acid proline. It plays a crucial role in the biosynthesis of collagen, a major component of connective tissues. This compound is employed in research and pharmaceutical synthesis, contributing to advancements in collagen-related studies and potential therapeutic applications.
CAS Number | 441067-49-8 |
Molecular Formula | C5H10ClNO3 |
Purity | ≥95% |
Target | PROTAC |
IUPAC Name | (2S,4S)-4-hydroxypyrrolidine-2-carboxylic acid;hydrochloride |
InChI | InChI=1S/C5H9NO3.ClH/c7-3-1-4(5(8)9)6-2-3;/h3-4,6-7H,1-2H2,(H,8,9);1H/t3-,4-;/m0./s1 |
InChIKey | YEJFFQAGTXBSTI-MMALYQPHSA-N |
SMILES | C1C(CNC1C(=O)O)O.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |