For research use only. Not for therapeutic Use.
Cis-4-Hydroxy-lomustine is a derivative of the chemotherapy drug lomustine, used in cancer treatment. This compound specifically targets and interferes with DNA synthesis in cancer cells, enhancing its effectiveness. Research focuses on its potential to improve therapeutic outcomes in brain tumors and other malignancies. Its unique cis-configuration contributes to its enhanced pharmacological properties and cancer-fighting capabilities.
Catalog Number | R029946 |
CAS Number | 52049-26-0 |
Synonyms | 1-(2-Chloroethyl)-3-(cis-4-hydroxycyclohexyl)-1-nitrosourea; N-(2-Chloroethyl)-N’-(cis-4-hydroxycyclohexyl)-N-nitrosourea; NSC 239724; cis-4-Hydroxy CCNU |
Molecular Formula | C9H16ClN3O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-(2-chloroethyl)-3-(4-hydroxycyclohexyl)-1-nitrosourea |
InChI | InChI=1S/C9H16ClN3O3/c10-5-6-13(12-16)9(15)11-7-1-3-8(14)4-2-7/h7-8,14H,1-6H2,(H,11,15) |
InChIKey | BTNKSMIZKSHDNT-UHFFFAOYSA-N |
SMILES | C1CC(CCC1NC(=O)N(CCCl)N=O)O |