For research use only. Not for therapeutic Use.
cis-4-Isopropylcyclohexanecarboxylic Acid is a cyclohexane derivative used in organic synthesis and pharmaceutical research. It serves as a building block for creating various biologically active compounds. This compound is essential for studying stereochemistry and developing new therapeutic agents, ensuring precise and reliable results in advanced chemical synthesis and drug development.
| Catalog Number | R015477 |
| CAS Number | 7084-93-7 |
| Synonyms | cis-p-Menthan-7-oic acid |
| Molecular Formula | C10H18O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-propan-2-ylcyclohexane-1-carboxylic acid |
| InChI | InChI=1S/C10H18O2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h7-9H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | YRQKWRUZZCBSIG-UHFFFAOYSA-N |
| SMILES | CC(C)C1CCC(CC1)C(=O)O |
