For research use only. Not for therapeutic Use.
Cis-7-Hexadecenoic Acid (Cat.No:R016854) is a naturally occurring unsaturated fatty acid commonly found in various plant and animal fats. It plays a role in lipid metabolism and can be used as a precursor in the synthesis of compounds with potential applications in the food, pharmaceutical, and cosmetic industries.
| Catalog Number | R016854 |
| CAS Number | 2416-19-5 |
| Synonyms | 7Z-hexadecenoic acid |
| Molecular Formula | C16H30O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (Z)-hexadec-7-enoic acid |
| InChI | InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h9-10H,2-8,11-15H2,1H3,(H,17,18)/b10-9- |
| InChIKey | PJHOFUXBXJNUAC-KTKRTIGZSA-N |
| SMILES | CCCCCCCCC=CCCCCCC(=O)O |
| Reference | 1.Knief, C.,Altendorf, K., and Lipski, A. Linking autotrophic activity in enviromental samples with specific bacterial taxa by detection of 13C-labelled fatty acids. Environmental Microbiology 5(11), 1155-1167 (2003). |
