For research use only. Not for therapeutic Use.
Cis-ACBD (Cat No.:I010185) is a synthetic lipid compound used in biological and pharmacological research. It is a member of the acylglycerophosphocholine class of molecules, which are important in cell signaling and lipid metabolism. Cis-ACBD exhibits structural features that make it valuable for studying the roles of phospholipids and their interaction with cellular membranes. Researchers investigate cis-ACBD for its potential in modulating lipid-based signaling pathways, which could have applications in understanding diseases related to cellular dysfunction, such as cancer, inflammation, and neurological disorders. Its full therapeutic potential is still under exploration.
| Catalog Number | I010185 |
| CAS Number | 73550-55-7 |
| Synonyms | cis-1-Aminocyclobutane-1,3-dicarboxylic acid |
| Molecular Formula | C6H9NO4 |
| Purity | ≥95% |
| Target | Glutamate (EAAT) Transporters |
| Solubility | Soluble to 100 mM in 1eq. NaOH |
| Storage | Store at RT |
| IUPAC Name | 1-aminocyclobutane-1,3-dicarboxylic acid |
| InChI | InChI=1S/C6H9NO4/c7-6(5(10)11)1-3(2-6)4(8)9/h3H,1-2,7H2,(H,8,9)(H,10,11) |
| InChIKey | GGMYWPBNZXRMME-UHFFFAOYSA-N |
| SMILES | C1C(CC1(C(=O)O)N)C(=O)O |
