For research use only. Not for therapeutic Use.
Potent, competitive and selective inhibitor of glutamate uptake. Certain confusion exists over the naming of this compound because of apparent contradictions in the literature. This is the isomer which has the carboxylic acid and the amino groups on the same side of the cyclobutyl ring.
| Catalog Number | I010185 |
| CAS Number | 73550-55-7 |
| Synonyms | cis-1-Aminocyclobutane-1,3-dicarboxylic acid |
| Molecular Formula | C6H9NO4 |
| Purity | ≥95% |
| Target | Glutamate (EAAT) Transporters |
| Solubility | Soluble to 100 mM in 1eq. NaOH |
| Storage | Store at RT |
| IUPAC Name | 1-aminocyclobutane-1,3-dicarboxylic acid |
| InChI | InChI=1S/C6H9NO4/c7-6(5(10)11)1-3(2-6)4(8)9/h3H,1-2,7H2,(H,8,9)(H,10,11) |
| InChIKey | GGMYWPBNZXRMME-UHFFFAOYSA-N |
| SMILES | C1C(CC1(C(=O)O)N)C(=O)O |
