For research use only. Not for therapeutic Use.
cis-Khellactone is a naturally occurring furanocoumarin found in certain plant species like Ammi visnaga. It exhibits a range of pharmacological activities, including vasodilatory and anti-inflammatory effects. Research into cis-Khellactone explores its potential therapeutic applications, particularly in treating cardiovascular conditions such as hypertension and angina. Its unique structure makes it a subject of interest in natural product chemistry and drug development.
CAS Number | 15645-11-1 |
Synonyms | 9,10-Dihydro-9,10-dihydroxy-8,8-dimethyl-2H,8H-Benzo[1,2-b:3,4-b’]dipyran-2-one, , stereoisomer; (±)-cis-Khellactone |
Molecular Formula | C14H14O5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (9S,10S)-9,10-dihydroxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one |
InChI | InChI=1S/C14H14O5/c1-14(2)13(17)11(16)10-8(19-14)5-3-7-4-6-9(15)18-12(7)10/h3-6,11,13,16-17H,1-2H3/t11-,13-/m0/s1 |
InChIKey | HKXQUNNSKMWIKJ-AAEUAGOBSA-N |
SMILES | CC1(C(C(C2=C(O1)C=CC3=C2OC(=O)C=C3)O)O)C |