For research use only. Not for therapeutic Use.
(+)-cis-Khellactone is a natural compound derived from plants of the Ammi visnaga species. It exhibits various pharmacological activities, including smooth muscle relaxant and vasodilatory effects. This compound is studied for its potential therapeutic applications in treating cardiovascular conditions, such as hypertension and angina pectoris. Its ability to modulate vascular tone and blood flow makes it a subject of interest in medicinal chemistry research.
CAS Number | 24144-61-4 |
Synonyms | (9R,10R)-9,10-Dihydro-9,10-dihydroxy-8,8-dimethyl-2H,8H-Benzo[1,2-b:3,4-b’]dipyran-2-one; (9R-cis)-9,10-Dihydro-9,10-dihydroxy-8,8-dimethyl-2H,8H-Benzo[1,2-b:3,4-b’]dipyran-2-one; 9,10-Dihydro-9,10-dihydroxy-8,8-dimethyl-2H,8H-Benz |
Molecular Formula | C14H14O5 |
Purity | ≥95% |
Target | Plants |
Storage | -20°C |
IUPAC Name | (9R,10R)-9,10-dihydroxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one |
InChI | InChI=1S/C14H14O5/c1-14(2)13(17)11(16)10-8(19-14)5-3-7-4-6-9(15)18-12(7)10/h3-6,11,13,16-17H,1-2H3/t11-,13-/m1/s1 |
InChIKey | HKXQUNNSKMWIKJ-DGCLKSJQSA-N |
SMILES | CC1(C(C(C2=C(O1)C=CC3=C2OC(=O)C=C3)O)O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |