For research use only. Not for therapeutic Use.
cis-N-(3-Chloroallyl)-1-(R)-aminoindan hydrochloride (Cat No.:C000774) is a chemical compound featuring a chlorophyll group and an (R)-aminoindan moiety connected in a cis arrangement. This intricate structure suggests potential significance in medicinal chemistry. The compound’s unique configuration may influence its interactions with biological systems, making it of interest to researchers exploring potential therapeutic applications.
| Catalog Number | C000774 |
| CAS Number | 1175018-80-0 |
| Synonyms | N-Desopropargyl N-(1-chloroprop-1-ene) Hydrochloride; |
| Molecular Formula | C₁₂H₁₄ClN • HCl |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| Appearance | Pale Yellow to Yellow Solid |
| Storage | -20°C, Inert atmosphere, Light sensitive |
| IUPAC Name | (1R)-N-[(Z)-3-chloroprop-2-enyl]-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChI | InChI=1S/C12H14ClN.ClH/c13-8-3-9-14-12-7-6-10-4-1-2-5-11(10)12;/h1-5,8,12,14H,6-7,9H2;1H/b8-3-;/t12-;/m1./s1 |
| InChIKey | XSGWVDYIYJOVCZ-ZDFSRXSCSA-N |
| SMILES | C1CC2=CC=CC=C2C1NCC=CCl.Cl |
| Reference | Sterling, Jeffrey, et al.: Teva Pharmaceutical Industries, US 7572834 (2009) |
