Home
>
Chemical Reagents>Heterocyclic Building Blocks> cis-n-Benzyl-4-methylcyclohexanamine hydrochloride
For research use only. Not for therapeutic Use.
cis-n-Benzyl-4-methylcyclohexanamine hydrochloride(Cat No.:L015951)is a cyclic amine compound used in pharmaceutical research and organic synthesis. This molecule features a cyclohexane ring with a methyl group at the 4-position and a benzyl group attached to the nitrogen atom, existing in the cis-configuration. As a hydrochloride salt, it is more stable and soluble, making it easier to handle in laboratory settings. It serves as a valuable intermediate in the synthesis of bioactive compounds, including potential therapeutic agents, and supports advanced research in medicinal chemistry and drug development.
CAS Number | 2089378-67-4 |
Molecular Formula | C14H22ClN |
Purity | ≥95% |
IUPAC Name | N-benzyl-4-methylcyclohexan-1-amine;hydrochloride |
InChI | InChI=1S/C14H21N.ClH/c1-12-7-9-14(10-8-12)15-11-13-5-3-2-4-6-13;/h2-6,12,14-15H,7-11H2,1H3;1H |
InChIKey | IJNCOKYVIASNSH-UHFFFAOYSA-N |
SMILES | CC1CCC(CC1)NCC2=CC=CC=C2.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |