For research use only. Not for therapeutic Use.
cis-Piceatannol is a natural polyphenolic compound and a cis-isomer of piceatannol, derived from resveratrol. Known for its antioxidant and anti-inflammatory properties, it has garnered interest in biomedical research for potential therapeutic applications, particularly in cancer prevention and cardiovascular health. The compound exhibits various biological activities, including modulation of cell signaling pathways, inhibition of cancer cell proliferation, and protection against oxidative stress. Its unique structure enables interaction with multiple cellular targets, enhancing its efficacy. Ongoing studies aim to elucidate the full range of pharmacological effects of cis-Piceatannol, making it a promising candidate for future therapeutic development.
| Catalog Number | R012220 |
| CAS Number | 106325-86-4 |
| Synonyms | 4-[(1Z)-2-(3,5-Dihydroxyphenyl)ethenyl]-1,2-benzenediol; |
| Molecular Formula | C14H12O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-[(Z)-2-(3,5-dihydroxyphenyl)ethenyl]benzene-1,2-diol |
| InChI | InChI=1S/C14H12O4/c15-11-5-10(6-12(16)8-11)2-1-9-3-4-13(17)14(18)7-9/h1-8,15-18H/b2-1- |
| InChIKey | CDRPUGZCRXZLFL-UPHRSURJSA-N |
| SMILES | C1=CC(=C(C=C1C=CC2=CC(=CC(=C2)O)O)O)O |
