For research use only. Not for therapeutic Use.
cis-Resveratrol(Cat No.:R007773)is a natural polyphenolic compound found in various plants, including grapes and berries, and is a geometric isomer of the more common trans-resveratrol. It exhibits antioxidant, anti-inflammatory, and anticancer properties, making it a valuable molecule in biomedical research. cis-Resveratrol plays a role in modulating signaling pathways, including those related to oxidative stress and apoptosis, and has shown potential in cardiovascular and neuroprotective studies. Its bioavailability and distinct activity compared to trans-resveratrol make it significant for exploring the therapeutic potential of resveratrol isomers in various diseases.
CAS Number | 61434-67-1 |
Synonyms | 5-[(1Z)-2-(4-Hydroxyphenyl)ethenyl]-1,3-benzenediol; cis-3,4’,5-Trihydroxystilbene; Z-5-[2-(4-Hydroxyphenyl)ethenyl]-1,3-benzenediol; (Z)-Resveratrol; |
Molecular Formula | C14H12O3 |
Purity | ≥95% |
Target | Enterovirus |
Storage | -80°C |
IUPAC Name | 5-[(Z)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
InChI | InChI=1S/C14H12O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-9,15-17H/b2-1- |
InChIKey | LUKBXSAWLPMMSZ-UPHRSURJSA-N |
SMILES | C1=CC(=CC=C1/C=C\C2=CC(=CC(=C2)O)O)O |