For research use only. Not for therapeutic Use.
cis/trans-Nepetalactol (Cat No.:C000726) is a chemical compound found in catnip (Nepeta cataria) and certain other plants. It is a stereoisomeric pair with one isomer being cis and the other trans. Nepetalactol contributes to the characteristic attraction of cats to catnip due to its effects on their behavior. It interacts with cat sensory receptors, particularly those associated with smell, inducing playful and euphoric responses. Research into the effects and mechanisms of cis/trans-Nepetalactol sheds light on the fascinating interactions between plants and animals and their potential applications in studying sensory perception and behavior.
| Catalog Number | C000726 |
| CAS Number | 109215-55-6 |
| Synonyms | (4aS,7S,7aR)-4,7-Dimethyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-ol; (4aS,7S,7aR)-1,4a,5,6,7,7a-Hexahydro-4,7-dimethyl-cyclopenta[c]pyran-1-ol; 1,4a,5,6,7,7a-Hexahydro-4,7-dimethyl-cyclopenta[c]pyran-1-ol; (4aS,7S,7aR)-Nepetalactol; Nepetalactol; |
| Molecular Formula | C₁₀H₁₆O₂ |
| Purity | ≥95% |
| Solubility | Benzene (Slightly), Chloroform (Sparingly), Methanol (Slightly) |
| Appearance | Colourless to Pale Yellow Oil to Thick Oil |
| Storage | -20°C, Inert atmosphere, Light sensitive |
| IUPAC Name | 4,7-dimethyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-ol |
| InChI | InChI=1S/C10H16O2/c1-6-3-4-8-7(2)5-12-10(11)9(6)8/h5-6,8-11H,3-4H2,1-2H3 |
| InChIKey | OJGPEAXUHQRLNC-UHFFFAOYSA-N |
| SMILES | CC1CCC2C1C(OC=C2C)O |
| Reference | Dawson, G., et al.: Nature (London, U. K.), 325, 614 (1987) |
