For research use only. Not for therapeutic Use.
Citadiol hydrobromide (Cat No.:R021486) is a chemical compound used in pharmaceutical research. It is a synthetic derivative of estradiol, a natural estrogen hormone. Citadiol hydrobromide is studied for its potential therapeutic applications in treating various medical conditions related to hormonal imbalances and reproductive health. As a selective estrogen receptor modulator (SERM), it interacts with estrogen receptors in specific tissues, potentially offering benefits like hormone replacement therapy without some of the associated risks.
CAS Number | 103146-26-5 |
Synonyms | 4-[4-(Dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)-benzonitrile Hydrobromide; 4-[4-(Dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile Hydrobromide; 4-[4-(Dimethylamino)-1-(4’-fluorophenyl)-1-[hydro |
Molecular Formula | C20H24BrFN2O2 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 4-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile;hydrobromide |
InChI | InChI=1S/C20H23FN2O2.BrH/c1-23(2)11-3-10-20(25,17-5-7-18(21)8-6-17)19-9-4-15(13-22)12-16(19)14-24;/h4-9,12,24-25H,3,10-11,14H2,1-2H3;1H |
InChIKey | RVGFHORHCHHPCZ-UHFFFAOYSA-N |
SMILES | CN(C)CCCC(C1=CC=C(C=C1)F)(C2=C(C=C(C=C2)C#N)CO)O.Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |