For research use only. Not for therapeutic Use.
Citalopram-d4 hydrobromide(Cat No.:S000284) is a deuterated form of citalopram hydrobromide, with four hydrogen atoms replaced by deuterium, increasing its molecular stability. This modification enhances its utility as an internal standard for precise analytical methods such as mass spectrometry and NMR spectroscopy. Citalopram is an antidepressant in the selective serotonin reuptake inhibitor (SSRI) class, commonly used to treat depression. Deuterium in citalopram-d4 hydrobromide allows for more detailed pharmacokinetic and metabolic studies, providing clearer insights into the drug’s absorption, distribution, metabolism, and elimination processes.
Catalog Number | S000284 |
CAS Number | 1219803-58-3 |
Molecular Formula | C20H18D4BrFN2O |
Purity | ≥95% |
IUPAC Name | 1-[3-(dimethylamino)propyl]-1-(2,3,5,6-tetradeuterio-4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile;hydrobromide |
InChI | InChI=1S/C20H21FN2O.BrH/c1-23(2)11-3-10-20(17-5-7-18(21)8-6-17)19-9-4-15(13-22)12-16(19)14-24-20;/h4-9,12H,3,10-11,14H2,1-2H3;1H/i5D,6D,7D,8D; |
InChIKey | WIHMBLDNRMIGDW-VBMPRCAQSA-N |
SMILES | CN(C)CCCC1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=C(C=C3)F.Br |