For research use only. Not for therapeutic Use.
Citric Acid-2,2,4,4-d4 is a deuterated form of citric acid, where four hydrogen atoms are replaced by deuterium. This compound is primarily used in NMR spectroscopy and mass spectrometry to study metabolic pathways, reaction mechanisms, and isotope effects with enhanced precision. Citric acid is a key intermediate in the citric acid cycle (Krebs cycle), which is crucial for cellular respiration and energy production in living organisms. The deuterium labeling allows researchers to track the movement and transformation of citric acid in biochemical studies and industrial processes without altering its chemical reactivity.
Catalog Number | R008183 |
CAS Number | 147664-83-3 |
Synonyms | 2-Hydroxy-1,2,3-propanetricarboxylic-d4 Acid; Chemfill-d4; Citretten-d4; 2-Hydroxypropan-d4-1,2,3-tricarboxylic Acid; Citro-d4; E 330-d4; 3-Carboxy-3-hydroxypentane-d4-1,5-dioic Acid; Aciletten-d4; Celenex 3P6-d4; |
Molecular Formula | C6H8O7 |
Purity | ≥95% |
Target | Anti-infection |
Storage | Store at +4C |
IUPAC Name | 1,1,3,3-tetradeuterio-2-hydroxypropane-1,2,3-tricarboxylic acid |
InChI | InChI=1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/i1D2,2D2 |
InChIKey | KRKNYBCHXYNGOX-LNLMKGTHSA-N |
SMILES | [2H]C([2H])(C(=O)O)C(C(=O)O)(C([2H])([2H])C(=O)O)O |