For research use only. Not for therapeutic Use.
CK-666 (CAT: I005884) is a small molecule inhibitor that specifically targets the actin-related protein 2/3 (Arp2/3) complex. The Arp2/3 complex plays a crucial role in the regulation of actin polymerization, which is essential for various cellular processes, including cell migration, shape changes, and cellular protrusions. CK-666 binds to the Arp2/3 complex, inhibiting its nucleation activity and preventing the formation of branched actin networks. By disrupting actin dynamics, CK-666 impairs the ability of cells to undergo cytoskeletal rearrangements necessary for processes like cell motility and invasion. CK-666 is commonly used as a research tool to investigate the functional significance of the Arp2/3 complex and its involvement in cellular processes and diseases related to actin cytoskeleton dynamics.
| Catalog Number | I005884 |
| CAS Number | 442633-00-3 |
| Synonyms | 2-Fluoro-N-[2-(2-methyl-1H-indol-3-​yl)ethyl]benzamide |
| Molecular Formula | C18H17FN2O |
| Purity | ≥95% |
| Target | Anti-infection |
| Solubility | Soluble to 100 mM in DMSO and to 100 mM in ethanol |
| Storage | Store at -20°C |
| IUPAC Name | 2-fluoro-N-[2-(2-methyl-1H-indol-3-yl)ethyl]benzamide |
| InChI | InChI=1S/C18H17FN2O/c1-12-13(14-6-3-5-9-17(14)21-12)10-11-20-18(22)15-7-2-4-8-16(15)19/h2-9,21H,10-11H2,1H3,(H,20,22) |
| InChIKey | UXRKUKRXVWJFER-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1)CCNC(=O)C3=CC=CC=C3F |
| Reference | 1: Hetrick B, Han MS, Helgeson LA, Nolen BJ. Small molecules CK-666 and CK-869 |
