For research use only. Not for therapeutic Use.
CK1-IN-2 (CAT: I040911) is a potent inhibitor of casein kinase 1 (CK1) isoforms, with IC50 values of 123 nM for CK1α, 19.8 nM for CK1δ, 26.8 nM for CK1ε, and 74.3 nM for p38α. CK1 is involved in regulating various cellular processes, including the circadian rhythm, cell cycle, and signal transduction. By inhibiting these isoforms, CK1-IN-2 has the potential to modulate these processes, making it valuable for research into diseases where CK1 activity is dysregulated, such as cancer, neurodegenerative disorders, or inflammatory conditions. This compound can be used in studies related to Inflammation & Immunology Research, Neurological Disease Research, and Cancer Disease Research.
| CAS Number | 1383376-92-8 |
| Synonyms | 4-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]-7H-furo[3,4-b]pyridin-5-one |
| Molecular Formula | C17H12FN3O2 |
| Purity | ≥95% |
| IUPAC Name | 4-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]-7H-furo[3,4-b]pyridin-5-one |
| InChI | InChI=1S/C17H12FN3O2/c1-21-8-13(16(20-21)10-2-4-11(18)5-3-10)12-6-7-19-14-9-23-17(22)15(12)14/h2-8H,9H2,1H3 |
| InChIKey | XISSYJGQGSMWHO-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C2=CC=C(C=C2)F)C3=C4C(=NC=C3)COC4=O |
