For research use only. Not for therapeutic Use.
Cladosporin（Cat No.:I024877）is a naturally occurring fungal metabolite with notable antimicrobial and anticancer properties. Isolated from Cladosporium cladosporioides, it has shown activity against various bacterial and fungal pathogens, making it a potential candidate for the development of new antibiotics. Additionally, cladosporin has demonstrated cytotoxic effects on cancer cells, particularly in inhibiting tumor growth and inducing apoptosis. Its mechanism of action involves the disruption of cellular processes, including protein synthesis and cell division. Due to its broad-spectrum antimicrobial and anticancer activities, cladosporin is being investigated for therapeutic applications in infectious diseases and cancer treatment.
| CAS Number | 35818-31-6 |
| Synonyms | (3R)-6,8-dihydroxy-3-[[(2R,6S)-6-methyloxan-2-yl]methyl]-3,4-dihydroisochromen-1-one |
| Molecular Formula | C16H20O5 |
| Purity | ≥95% |
| IUPAC Name | (3R)-6,8-dihydroxy-3-[[(2R,6S)-6-methyloxan-2-yl]methyl]-3,4-dihydroisochromen-1-one |
| InChI | InChI=1S/C16H20O5/c1-9-3-2-4-12(20-9)8-13-6-10-5-11(17)7-14(18)15(10)16(19)21-13/h5,7,9,12-13,17-18H,2-4,6,8H2,1H3/t9-,12+,13+/m0/s1 |
| InChIKey | WOMKDMUZNBFXKG-ZWKOPEQDSA-N |
| SMILES | C[C@H]1CCC[C@@H](O1)C[C@H]2CC3=C(C(=CC(=C3)O)O)C(=O)O2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
