For research use only. Not for therapeutic Use.
Clausine Z is a natural compound isolated from the plant Clausena lansium, known for its diverse biological activities. This furanocoumarin has garnered interest in pharmacology due to its potential anticancer, anti-inflammatory, and antimicrobial properties. Research indicates that Clausine Z may inhibit cell proliferation and induce apoptosis in cancer cells, making it a promising candidate for drug development. Its unique structure and bioactivity highlight the importance of natural products in medicinal chemistry, encouraging further studies to explore its therapeutic potential and mechanisms of action.
| Catalog Number | R014956 |
| CAS Number | 866111-14-0 |
| Synonyms | 1,6-dihydroxy-9H-carbazole-3-carbaldehyde; ClausineZ; Clausine-Z; |
| Molecular Formula | C13H9NO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1,6-dihydroxy-9H-carbazole-3-carbaldehyde |
| InChI | InChI=1S/C13H9NO3/c15-6-7-3-10-9-5-8(16)1-2-11(9)14-13(10)12(17)4-7/h1-6,14,16-17H |
| InChIKey | FKDULSCBYNXNMP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C3=CC(=CC(=C3N2)O)C=O |
