For research use only. Not for therapeutic Use.
Clazuril（Cat No.:M002614）is a broad-spectrum anticoccidial agent used primarily in veterinary medicine to prevent and treat coccidiosis in poultry and livestock. It targets Eimeria species, the causative agents of the disease, by disrupting their intracellular development and replication. Clazuril’s high efficacy and long-acting properties make it effective with minimal doses, reducing the parasite burden and supporting animal health. Its safety profile and compatibility with feed additives enhance its utility in farm management. Clazuril plays a crucial role in improving productivity and controlling parasitic infections in animal husbandry.
| Catalog Number | M002614 |
| CAS Number | 101831-36-1 |
| Synonyms | Clazurilum; Clazurilo |
| Molecular Formula | C17H10Cl2N4O2 |
| Purity | ≥95% |
| Target | Parasite |
| Storage | Desiccate at -20C |
| IUPAC Name | 2-[2-chloro-4-(3,5-dioxo-1,2,4-triazin-2-yl)phenyl]-2-(4-chlorophenyl)acetonitrile |
| InChI | InChI=1S/C17H10Cl2N4O2/c18-11-3-1-10(2-4-11)14(8-20)13-6-5-12(7-15(13)19)23-17(25)22-16(24)9-21-23/h1-7,9,14H,(H,22,24,25) |
| InChIKey | QUUTUGLQZLNABV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C#N)C2=C(C=C(C=C2)N3C(=O)NC(=O)C=N3)Cl)Cl |
| Reference | <p> |
