For research use only. Not for therapeutic Use.
Clencyclohexerol(CAT: R012338) is a long-acting β2-adrenergic receptor agonist known for its potent bronchodilatory and anabolic properties. It primarily acts by stimulating β2-adrenergic receptors, leading to smooth muscle relaxation and enhanced airflow in the respiratory tract. Beyond its bronchodilator effects, Clencyclohexerol has been studied for its ability to promote muscle growth and reduce fat deposition, making it of interest in metabolic and muscle physiology research. It is commonly used in veterinary medicine and research models to investigate β-adrenergic signaling, metabolic regulation, and potential therapeutic applications in respiratory and muscular disorders.
| CAS Number | 157877-79-7 |
| Synonyms | 4-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]cyclohexan-1-ol |
| Molecular Formula | C14H20Cl2N2O2 |
| Purity | ≥95% |
| IUPAC Name | 4-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]cyclohexan-1-ol |
| InChI | InChI=1S/C14H20Cl2N2O2/c15-11-5-8(6-12(16)14(11)17)13(20)7-18-9-1-3-10(19)4-2-9/h5-6,9-10,13,18-20H,1-4,7,17H2 |
| InChIKey | DKFLKXDTRUWFDL-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1NCC(C2=CC(=C(C(=C2)Cl)N)Cl)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
