For research use only. Not for therapeutic Use.
Clenproperol is a β2-adrenergic agonist[1].
| Catalog Number | R013791 |
| CAS Number | 38339-11-6 |
| Synonyms | 1-(4-amino-3,5-dichlorophenyl)-2-(propan-2-ylamino)ethanol |
| Molecular Formula | C11H16Cl2N2O |
| Purity | ≥95% |
| InChI | InChI=1S/C11H16Cl2N2O/c1-6(2)15-5-10(16)7-3-8(12)11(14)9(13)4-7/h3-4,6,10,15-16H,5,14H2,1-2H3 |
| InChIKey | JXUDZCJTCKCTQK-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(C1=CC(=C(C(=C1)Cl)N)Cl)O |
| Reference | [1]. González-Antuña A, et al. Simultaneous determination of seven β2-agonists in human and bovine urine by isotope dilution liquid chromatography-tandem mass spectrometry using compound-specific minimally 13C-labelled analogues. J Chromatogr A. 2014;1372C:63-71. |
