Cleroindicin B

For research use only. Not for therapeutic Use.

  • CAT Number: M127038
  • CAS Number: 107389-91-3
  • Molecular Formula: C8H14O3
  • Molecular Weight: 158.197
  • Purity: ≥95%
Inquiry Now

Cleroindicin B is a naturally occurring phenolic compound known for its biological activity and potential therapeutic applications. Isolated from certain plant sources, it exhibits antimicrobial, anti-inflammatory, and antioxidant properties, making it of interest in pharmacological research. The compound’s unique structure allows for interactions with various biological targets, potentially leading to the development of new drugs. Additionally, Cleroindicin B serves as a valuable lead compound in the synthesis of derivatives aimed at enhancing its efficacy and specificity in medical applications.


CAS Number 107389-91-3
Molecular Formula C8H14O3
Purity ≥95%
Target Plants
Storage -20°C
IUPAC Name 4-hydroxy-4-(2-hydroxyethyl)cyclohexan-1-one
InChI InChI=1S/C8H14O3/c9-6-5-8(11)3-1-7(10)2-4-8/h9,11H,1-6H2
InChIKey QLSFMYCHPVOSCD-UHFFFAOYSA-N
SMILES C1CC(CCC1=O)(CCO)O

Request a Quote