For research use only. Not for therapeutic Use.
Cleroindicin F(Cat No.:R063487)is a bioactive compound isolated from the fermentation of Clerodendrum species, known for its potential pharmacological activities. It exhibits notable antimicrobial and anticancer properties, making it a valuable candidate for drug development. Cleroindicin F’s mechanism of action includes inhibiting cell proliferation and inducing apoptosis in cancer cell lines, as well as exhibiting activity against various pathogenic microorganisms. Its promising biological effects suggest that it may be further explored for therapeutic applications in cancer treatment and infectious disease management, although more research is needed to fully understand its pharmacokinetics and clinical potential.
CAS Number | 189264-47-9 |
Molecular Formula | C8H10O3 |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | (3aR,7aR)-3a-hydroxy-2,3,7,7a-tetrahydro-1-benzofuran-6-one |
InChI | InChI=1S/C8H10O3/c9-6-1-2-8(10)3-4-11-7(8)5-6/h1-2,7,10H,3-5H2/t7-,8+/m1/s1 |
InChIKey | HSGPAWIMHOPPDA-SFYZADRCSA-N |
SMILES | C1CO[C@H]2[C@@]1(C=CC(=O)C2)O |