For research use only. Not for therapeutic Use.
Cletoquine Oxalate(Cat No.:R008551) is a synthetic compound that is a salt of cletoquine, an antimalarial drug. Its mode of action involves being an antimalarial agent that inhibits the growth and development of the malaria parasite Plasmodium. Pharmacologically, Cletoquine Oxalate is used for the treatment and prevention of malaria, particularly caused by Plasmodium falciparum and Plasmodium vivax strains that are resistant to other antimalarial drugs. It is commonly used in combination therapy with other antimalarials to enhance its efficacy and reduce the risk of developing resistance.
CAS Number | 14142-64-4 |
Synonyms | 2-[[4-[(7-Chloro-4-quinolinyl)amino]pentyl]amino]ethanol Oxalate; (+/-)-Desethylhydroxychloroquine Oxalate; |
Molecular Formula | C18H24ClN3O5 |
Purity | ≥95% |
Target | Influenza Virus |
Storage | Store at -20°C |
IUPAC Name | 2-[4-[(7-chloroquinolin-4-yl)amino]pentylamino]ethanol;oxalic acid |
InChI | InChI=1S/C16H22ClN3O.C2H2O4/c1-12(3-2-7-18-9-10-21)20-15-6-8-19-16-11-13(17)4-5-14(15)16;3-1(4)2(5)6/h4-6,8,11-12,18,21H,2-3,7,9-10H2,1H3,(H,19,20);(H,3,4)(H,5,6) |
InChIKey | DTVGVTDECKJJJK-UHFFFAOYSA-N |
SMILES | CC(CCCNCCO)NC1=C2C=CC(=CC2=NC=C1)Cl.C(=O)(C(=O)O)O |