For research use only. Not for therapeutic Use.
Cletoquine（Cat No.:R045324）, also known as Desethylhydroxychloroquine, is the primary active metabolite of Hydroxychloroquine, formed in the liver by various cytochrome P450 isozymes (CYP2D6, CYP3A4, CYP3A5, and CYP2C8). As a derivative of Chloroquine, Cletoquine possesses antimalarial properties. Moreover, it exhibits anti-chikungunya virus (CHIKV) abilities, making it a potential candidate for combating CHIKV infections. Additionally, Cletoquine is used in research on autoimmune diseases, further expanding its significance in pharmacology and medical studies related to infectious diseases and immune-related disorders.
| Catalog Number | R045324 |
| CAS Number | 4298-15-1 |
| Synonyms | 2-[[4-[(7-Chloro-4-quinolyl)amino]pentyl]amino]ethanol; (±)-Desethylhydroxychloroquine; Desethylhydroxychloroquine |
| Molecular Formula | C16H22ClN3O |
| Purity | ≥95% |
| Target | Influenza Virus |
| Storage | -20°C |
| IUPAC Name | 2-[4-[(7-chloroquinolin-4-yl)amino]pentylamino]ethanol |
| InChI | InChI=1S/C16H22ClN3O/c1-12(3-2-7-18-9-10-21)20-15-6-8-19-16-11-13(17)4-5-14(15)16/h4-6,8,11-12,18,21H,2-3,7,9-10H2,1H3,(H,19,20) |
| InChIKey | XFICNUNWUREFDP-UHFFFAOYSA-N |
| SMILES | CC(CCCNCCO)NC1=C2C=CC(=CC2=NC=C1)Cl |
