For research use only. Not for therapeutic Use.
Clitocine(CAT: M003645) is a natural nucleoside compound found in certain species of mushrooms, particularly in the genus Clitocybe. Its mode of action involves being a nucleoside analog, and it has shown potential pharmacological properties. Clitocine has been studied for its antiviral and antitumor activities. As a nucleoside analog, it can interfere with viral replication and inhibit the growth of cancer cells. Due to its interesting bioactivity, Clitocine is of interest in medicinal research, particularly in antiviral and anticancer drug development.
| Catalog Number | M003645 |
| CAS Number | 105798-74-1 |
| Molecular Formula | C9H13N5O6 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | -20°C |
| IUPAC Name | (2R,3R,4S,5R)-2-[(6-amino-5-nitropyrimidin-4-yl)amino]-5-(hydroxymethyl)oxolane-3,4-diol |
| InChI | InChI=1S/C9H13N5O6/c10-7-4(14(18)19)8(12-2-11-7)13-9-6(17)5(16)3(1-15)20-9/h2-3,5-6,9,15-17H,1H2,(H3,10,11,12,13)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | OHEMBWZZEKCBAS-UUOKFMHZSA-N |
| SMILES | C1=NC(=C(C(=N1)NC2C(C(C(O2)CO)O)O)[N+](=O)[O-])N |
