For research use only. Not for therapeutic Use.
Clofibric-d4 Acid is a deuterated analog of Clofibric Acid, essential for advanced pharmaceutical and environmental research. This isotopically labeled compound aids in the precise study of drug metabolism, lipid regulation, and environmental impact. Its stable isotope labeling ensures accurate mass spectrometry and NMR analysis, providing reliable and reproducible data. Ideal for research on lipid-lowering agents, pollution monitoring, and metabolic pathways, Clofibric-d4 Acid enhances the understanding of its biological roles and potential applications, making it indispensable for innovative scientific investigations.
CAS Number | 1184991-14-7 |
Synonyms | 2-(4-Chlorophenoxy-d4)-2-methylpropanoic Acid; 2-(p-Chlorophenoxy-d4)-2-methylpropionic Acid; α-(p-Chlorophenoxy-d4)isobutyric Acid; Chlorophibrinic-d4 Acid; |
Molecular Formula | C10H11ClO3 |
Purity | ≥95% |
Target | Vitamin D Related/Nuclear Receptor |
Storage | -20°C |
IUPAC Name | 2-(4-chloro-2,3,5,6-tetradeuteriophenoxy)-2-methylpropanoic acid |
InChI | InChI=1S/C10H11ClO3/c1-10(2,9(12)13)14-8-5-3-7(11)4-6-8/h3-6H,1-2H3,(H,12,13)/i3D,4D,5D,6D |
InChIKey | TXCGAZHTZHNUAI-LNFUJOGGSA-N |
SMILES | CC(C)(C(=O)O)OC1=CC=C(C=C1)Cl |