For research use only. Not for therapeutic Use.
Clomipramine-d3 hydrochloride（Cat No.:S000351） is a deuterated version of clomipramine hydrochloride, where three hydrogen atoms are replaced with deuterium. Clomipramine is a tricyclic antidepressant primarily used to treat obsessive-compulsive disorder (OCD) and depression. The deuteration of clomipramine enhances the stability of the molecule, facilitating more precise pharmacokinetic and metabolic studies. These studies help researchers understand how the drug is absorbed, distributed, metabolized, and excreted, leading to better therapeutic management.
| Catalog Number | S000351 |
| CAS Number | 1398065-86-5 |
| Molecular Formula | C19H21D3Cl2N2 |
| Purity | ≥95% |
| IUPAC Name | 3-(2-chloro-5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methyl-N-(trideuteriomethyl)propan-1-amine;hydrochloride |
| InChI | InChI=1S/C19H23ClN2.ClH/c1-21(2)12-5-13-22-18-7-4-3-6-15(18)8-9-16-10-11-17(20)14-19(16)22;/h3-4,6-7,10-11,14H,5,8-9,12-13H2,1-2H3;1H/i1D3; |
| InChIKey | WIMWMKZEIBHDTH-NIIDSAIPSA-N |
| SMILES | CN(C)CCCN1C2=CC=CC=C2CCC3=C1C=C(C=C3)Cl.Cl |
