For research use only. Not for therapeutic Use.
Clopidogrel（Cat No.:A000707）is an antiplatelet medication used to reduce the risk of blood clots in conditions like heart attack, stroke, and peripheral artery disease. It works by inhibiting the P2Y12 ADP receptor on platelets, preventing platelet aggregation and reducing the formation of clots in arteries. Clopidogrel is often prescribed after stent placement or in combination with aspirin for dual antiplatelet therapy to improve cardiovascular outcomes. Its ability to prevent clot formation makes it a key treatment in managing atherosclerosis-related conditions and preventing recurrent cardiovascular events.
| Catalog Number | A000707 |
| CAS Number | 120202-66-6 |
| Synonyms | R-25990C |
| Molecular Formula | C16H16ClNO2S • H2SO4 |
| Purity | ≥95% |
| Target | GPCR/G Protein |
| Solubility | >19.7mg/mL in DMSO |
| Storage | 3 years -20C powder |
| IUPAC Name | methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;sulfuric acid |
| InChI | InChI=1S/C16H16ClNO2S.H2O4S/c1-20-16(19)15(12-4-2-3-5-13(12)17)18-8-6-14-11(10-18)7-9-21-14;1-5(2,3)4/h2-5,7,9,15H,6,8,10H2,1H3;(H2,1,2,3,4)/t15-;/m0./s1 |
| InChIKey | FDEODCTUSIWGLK-RSAXXLAASA-N |
| SMILES | COC(=O)[C@H](C1=CC=CC=C1Cl)N2CCC3=C(C2)C=CS3.OS(=O)(=O)O |
