For research use only. Not for therapeutic Use.
Clopyralid (Cat No.:R009578) is a selective herbicide used to control broadleaf weeds in agricultural and non-agricultural settings. It belongs to the pyridine group of chemicals and works by disrupting plant growth hormones, leading to uncontrolled growth and eventually plant death. Clopyralid is commonly employed on grasslands, pastures, lawns, and crops like cereals, corn, and sugarcane. However, its residual activity can cause issues if treated plant material is used as compost, as it can persist in the environment and affect susceptible plants.
| Catalog Number | R009578 |
| CAS Number | 1702-17-6 |
| Synonyms | 3,6-Dichloro-2-pyridinecarboxylic Acid; 3,6-Dichloro-2-picolinic Acid; ?Cirtoxin; Dichloro pyridine acid; Dowco 290; IWD 3523; Lontrel; Lontrel 100; Lontrel 3; Lontrel 300; Lontrel L; |
| Molecular Formula | C6H3Cl2NO2 |
| Purity | ≥95% |
| Storage | Room Temperature |
| IUPAC Name | 3,6-dichloropyridine-2-carboxylic acid |
| InChI | InChI=1S/C6H3Cl2NO2/c7-3-1-2-4(8)9-5(3)6(10)11/h1-2H,(H,10,11) |
| InChIKey | HUBANNPOLNYSAD-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Cl)C(=O)O)Cl |
