For research use only. Not for therapeutic Use.
Clorsulon（Cat No.:A000962）is a potent anti-parasitic agent primarily used in veterinary medicine for the treatment of liver fluke infestations in cattle and sheep. It works by inhibiting the enzyme fumarate reductase, essential for the survival of flukes, thereby impairing their energy metabolism. Clorsulon is typically administered orally or via injection, offering an effective solution for controlling Fasciola hepatica and other fluke species. Its use helps prevent the spread of parasitic infections, ensuring better livestock health and productivity. Clorsulon is generally well-tolerated with minimal side effects.
| Catalog Number | A000962 |
| CAS Number | 60200-06-8 |
| Synonyms | 60200-06-8; Curatrem; MK-401 |
| Molecular Formula | C8H8Cl3N3O4S2 |
| Purity | ≥95% |
| Target | Parasite |
| Storage | -20°C |
| IUPAC Name | 4-amino-6-(1,2,2-trichloroethenyl)benzene-1,3-disulfonamide |
| InChI | InChI=1S/C8H8Cl3N3O4S2/c9-7(8(10)11)3-1-4(12)6(20(14,17)18)2-5(3)19(13,15)16/h1-2H,12H2,(H2,13,15,16)(H2,14,17,18) |
| InChIKey | QOVTVIYTBRHADL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N)S(=O)(=O)N)S(=O)(=O)N)C(=C(Cl)Cl)Cl |
| Reference | 1: Saad AS, Ismail NS, Soliman M, Zaazaa HE. Validated Stability-Indicating 2: Martínez-Valladares M, Cordero-Pérez C, Rojo-Vázquez FA. Efficacy of an <br> <br> 5: Hutchinson GW, Dawson K, Fitzgibbon CC, Martin PJ. Efficacy of an injectable 6: Mossallam SF, Ali SM, El Zawawy LA, Said DE. The efficacy of antihelminthic 7: Meaney M, Allister J, McKinstry B, McLaughlin K, Brennan GP, Forbes AB, 8: Meaney M, Allister J, McKinstry B, McLaughlin K, Brennan GP, Forbes AB, 9: Meaney M, Haughey S, Brennan GP, Fairweather I. Ultrastructural observations 10: Meaney M, Haughey S, Brennan GP, Fairweather I. A scanning electron |
