For research use only. Not for therapeutic Use.
Closantel（Cat No.:A000921）is an antiparasitic agent commonly used in veterinary medicine for the treatment and prevention of fluke infections and certain helminthic diseases in livestock. This compound, a member of the salicylanilide class, is effective against gastrointestinal nematodes, lungworms, and liver flukes. Closantel works by inhibiting the mitochondrial function of the parasites, leading to their death. Its prolonged activity makes it suitable for both therapeutic and prophylactic treatments. Used primarily in ruminants, Closantel helps to control parasitic infestations, ensuring healthier livestock and improved agricultural productivity.
| Catalog Number | A000921 |
| CAS Number | 57808-65-8 |
| Synonyms | R-31520 |
| Molecular Formula | C22H14Cl2I2N2O2 |
| Purity | ≥95% |
| Target | Parasite |
| Storage | -20°C |
| IUPAC Name | N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide |
| InChI | InChI=1S/C22H14Cl2I2N2O2/c1-11-6-15(17(10-27)12-2-4-13(23)5-3-12)18(24)9-20(11)28-22(30)16-7-14(25)8-19(26)21(16)29/h2-9,17,29H,1H3,(H,28,30) |
| InChIKey | JMPFSEBWVLAJKM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1NC(=O)C2=C(C(=CC(=C2)I)I)O)Cl)C(C#N)C3=CC=C(C=C3)Cl |
