For research use only. Not for therapeutic Use.
Clotrimazole（Cat No.:A000343）is a broad-spectrum antifungal agent used primarily in the treatment of various fungal infections, including dermatophytes, yeasts, and molds. It works by inhibiting the synthesis of ergosterol, a key component of fungal cell membranes, leading to cell membrane disruption and fungal death. Commonly applied topically, Clotrimazole is effective against skin infections like athlete’s foot, ringworm, and yeast infections. It is also used in oral formulations for systemic fungal infections. Clotrimazole is well-tolerated and provides effective antifungal activity with minimal systemic absorption.
| Catalog Number | A000343 |
| CAS Number | 23593-75-1 |
| Synonyms | Lotrimin; 23593-75-1; Canesten; Mycosporin; Mycelex |
| Molecular Formula | C22H17ClN2 |
| Purity | ≥95% |
| Target | Antibiotic |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | -20°C |
| IUPAC Name | 1-[(2-chlorophenyl)-diphenylmethyl]imidazole |
| InChI | InChI=1S/C22H17ClN2/c23-21-14-8-7-13-20(21)22(25-16-15-24-17-25,18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-17H |
| InChIKey | VNFPBHJOKIVQEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3Cl)N4C=CN=C4 |
| Reference | 1: Sakalli S, Burkina V, Pilipenko N, Zlabek V, Zamaratskaia G. In vitro effects <br> 3: Zhao Z, Bao L, Yu X, Zhu C, Xu J, Wang Y, Yin M, Li Y, Li W. Acute vanishing <br> 5: Bodiwala K, Shah S, Patel Y, Prajapati P, Marolia B, Kalyankar G. Simultaneous 6: Kavakçıoğlu B, Tarhan L. Yeast caspase-dependent apoptosis in Saccharomyces 7: Banaeian S, Sereshti M, Rafieian M, Farahbod F, Kheiri S. Comparison of 8: Kryczyk A, Żmudzki P, Koczurkiewicz P, Piotrowska J, Pękala E, Hubicka U. The <br> <br> |
