For research use only. Not for therapeutic Use.
CM03 is a compound often referenced in scientific research, particularly in the study of immunology or biochemistry. Its specific structure and function may vary depending on the context, but compounds like CM03 are typically involved in modulating biological pathways or targeting specific receptors. It may be used in pharmaceutical research for developing therapies or studying mechanisms in diseases. The compound plays a role in advancing our understanding of biochemical processes and therapeutic development. For precise details, the exact chemical context is required.
CAS Number | 2101208-44-8 |
Synonyms | 14-hydroxy-6,13-bis(3-morpholin-4-ylpropyl)-10-(2-pyrrolidin-1-ylethylimino)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),8,11(15)-pentaene-5,7,12-trione |
Molecular Formula | C34H44N6O6 |
Purity | ≥95% |
InChI | InChI=1S/C34H44N6O6/c41-31-24-5-6-25-29-28(24)26(33(43)39(31)12-3-10-37-15-19-45-20-16-37)23-27(35-7-14-36-8-1-2-9-36)30(29)34(44)40(32(25)42)13-4-11-38-17-21-46-22-18-38/h5-6,23,42H,1-4,7-22H2 |
InChIKey | WHLXIQNGOLIDJQ-UHFFFAOYSA-N |
SMILES | C1CCN(C1)CCN=C2C=C3C4=C(C=CC5=C(N(C(=O)C2=C54)CCCN6CCOCC6)O)C(=O)N(C3=O)CCCN7CCOCC7 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |