For research use only. Not for therapeutic Use.
CM572(Cat No.:I025020)is a small-molecule inhibitor targeting the protein kinase CK1δ (casein kinase 1 delta), which plays a role in regulating circadian rhythms, DNA damage response, and cell division. By inhibiting CK1δ, CM572 can potentially modulate biological processes such as cell cycle progression and tumorigenesis, making it a promising candidate for cancer treatment. Preclinical studies suggest CM572 could be effective in disrupting the growth of cancer cells, particularly in cancers where CK1δ is overexpressed or dysregulated. Its ability to influence cellular timing mechanisms positions it as a potential therapeutic agent in oncology and other disorders.
CAS Number | 1121932-91-9 |
Synonyms | CM572; CM-572; CM 572; |
Molecular Formula | C22H23FN4O2S |
Purity | 98% |
Target | Sigma Receptor |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | 3-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-6-isothiocyanato-1,3-benzoxazol-2-one |
InChI | InChI=1S/C22H23FN4O2S/c23-17-3-6-19(7-4-17)26-13-11-25(12-14-26)9-1-2-10-27-20-8-5-18(24-16-30)15-21(20)29-22(27)28/h3-8,15H,1-2,9-14H2 |
InChIKey | GMDKRSGIJNEPIP-UHFFFAOYSA-N |
SMILES | C1CN(CCN1CCCCN2C3=C(C=C(C=C3)N=C=S)OC2=O)C4=CC=C(C=C4)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |