For research use only. Not for therapeutic Use.
CML-d3 (Cat No.:S000723) is a deuterated form of carboxymethyllysine (CML), where three hydrogen atoms are replaced with deuterium, enhancing its molecular stability and making it ideal for use as an internal standard in precise analytical methods such as mass spectrometry and NMR spectroscopy. CML is an advanced glycation end product (AGE) that accumulates in tissues as a result of aging and diseases like diabetes and renal failure. The introduction of deuterium in CML-d3 allows for more accurate studies of its formation, accumulation, and biological effects in the body.
| Catalog Number | S000723 |
| CAS Number | 2699607-49-1 |
| Molecular Formula | C8H13D3N2O4 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-amino-6-(carboxymethylamino)-2,6,6-trideuteriohexanoic acid |
| InChI | InChI=1S/C8H16N2O4/c9-6(8(13)14)3-1-2-4-10-5-7(11)12/h6,10H,1-5,9H2,(H,11,12)(H,13,14)/t6-/m0/s1/i4D2,6D |
| InChIKey | NUXSIDPKKIEIMI-SASOZDAZSA-N |
| SMILES | C(CCNCC(=O)O)CC(C(=O)O)N |
