For research use only. Not for therapeutic Use.
CNG-10300（Cat No.:I025044）is an experimental small molecule being studied for its potential therapeutic applications in oncology and other diseases. It is designed to target specific cellular pathways involved in tumor growth, survival, and metastasis. Preclinical studies suggest that CNG-10300 may work by modulating key proteins or enzymes that regulate cancer cell proliferation and apoptosis. The compound has shown promise in overcoming resistance mechanisms that limit the effectiveness of existing cancer therapies. However, further clinical trials and research are necessary to fully evaluate its safety, efficacy, and potential for treating various cancer types and other conditions.
| Catalog Number | I025044 |
| Synonyms | CNG10300; CNG 10300; CNG-10300 |
| Molecular Formula | C12H13N3O4 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (2S)-2-amino-4-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)butanoic acid |
| InChI | InChI=1S/C12H13N3O4/c13-7(12(18)19)3-1-6-2-4-8-9(5-6)15-11(17)10(16)14-8/h2,4-5,7H,1,3,13H2,(H,14,16)(H,15,17)(H,18,19)/t7-/m0/s1 |
| InChIKey | HOBORVHHDCBXLX-ZETCQYMHSA-N |
| SMILES | C1=CC2=C(C=C1CC[C@@H](C(=O)O)N)NC(=O)C(=O)N2 |
| Reference | 1: Demmer CS, Møller C, Brown PM, Han L, Pickering DS, Nielsen B, Bowie D, Frydenvang K, Kastrup JS, Bunch L. Binding mode of an α-amino acid-linked quinoxaline-2,3-dione analogue at glutamate receptor subtype GluK1. ACS Chem Neurosci. 2015 Jun 17;6(6):845-54. doi: 10.1021/acschemneuro.5b00038. Epub 2015 Apr 9. PubMed PMID: 25856736. |
